About 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine
6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine (PubChem CID 16582431) has the molecular formula C14H13F2N7O2S
and a molecular weight of 381.37 g/mol. Its IUPAC name is 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine.
Molecular Properties
| Compound Name | 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine |
| PubChem CID | 16582431 |
| Molecular Formula | C14H13F2N7O2S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine |
| SMILES | O=S(=O)(c1c(F)cccc1F)N1CCN(c2ccc3nnnn3n2)CC1 |
| InChI | InChI=1S/C14H13F2N7O2S/c15-10-2-1-3-11(16)14(10)26(24,25)22-8-6-21(7-9-22)13-5-4-12-17-19-20-23(12)18-13/h1-5H,6-9H2 |
| InChIKey | PDTXTZRQNHJJQM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 96.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine?
The IUPAC name of 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine (CID 16582431) is 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine.
What is the SMILES notation for 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine?
The canonical SMILES for 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine is O=S(=O)(c1c(F)cccc1F)N1CCN(c2ccc3nnnn3n2)CC1.
What is the InChIKey of 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine?
The InChIKey is PDTXTZRQNHJJQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2N7O2S/c15-10-2-1-3-11(16)14(10)26(24,25)22-8-6-21(7-9-22)13-5-4-12-17-19-20-23(12)18-13/h1-5H,6-9H2.
What are the key properties of 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine?
6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine has a molecular weight of 381.37 g/mol, XLogP of 0.31, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]tetrazolo[1,5-b]pyridazine is sourced from PubChem (CID 16582431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).