About 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide
5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide (PubChem CID 16582452) has the molecular formula C9H9N7O2S2
and a molecular weight of 311.35 g/mol. Its IUPAC name is 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide |
| PubChem CID | 16582452 |
| Molecular Formula | C9H9N7O2S2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNc2ccc3nnnn3n2)s1 |
| InChI | InChI=1S/C9H9N7O2S2/c10-20(17,18)9-4-1-6(19-9)5-11-7-2-3-8-12-14-15-16(8)13-7/h1-4H,5H2,(H,11,13)(H2,10,17,18) |
| InChIKey | KPMXKUIQEYHWHA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 128.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide?
The IUPAC name of 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide (CID 16582452) is 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide?
The canonical SMILES for 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide is NS(=O)(=O)c1ccc(CNc2ccc3nnnn3n2)s1.
What is the InChIKey of 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide?
The InChIKey is KPMXKUIQEYHWHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N7O2S2/c10-20(17,18)9-4-1-6(19-9)5-11-7-2-3-8-12-14-15-16(8)13-7/h1-4H,5H2,(H,11,13)(H2,10,17,18).
What are the key properties of 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide?
5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide has a molecular weight of 311.35 g/mol, XLogP of -0.16, 4 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]thiophene-2-sulfonamide is sourced from PubChem (CID 16582452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).