C9H10N8OS2 — CID 16582461
N-(2-methoxyethyl)-5-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 16582461) has the molecular formula C9H10N8OS2 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-methoxyethyl)-5-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 16582461 |
| Molecular Formula | C9H10N8OS2 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | N-(2-methoxyethyl)-5-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COCCNc1nnc(Sc2ccc3nnnn3n2)s1 |
| InChI | InChI=1S/C9H10N8OS2/c1-18-5-4-10-8-12-13-9(20-8)19-7-3-2-6-11-15-16-17(6)14-7/h2-3H,4-5H2,1H3,(H,10,12) |
| InChIKey | UASKOOFSDGDREG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|