C28H24N4O2S — CID 16583662
N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 16583662) has the molecular formula C28H24N4O2S and a molecular weight of 480.59 g/mol. Its IUPAC name is N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 16583662 |
| Molecular Formula | C28H24N4O2S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)Nc1nc2c(s1)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C28H24N4O2S/c33-26(18-32-23-12-6-4-10-20(23)27(34)21-11-5-7-13-24(21)32)30-28-29-22-14-15-31(17-25(22)35-28)16-19-8-2-1-3-9-19/h1-13H,14-18H2,(H,29,30,33) |
| InChIKey | HNWMNPWDNIZRCJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|