C26H23F2N3O6 — CID 16583793
2-[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 16583793) has the molecular formula C26H23F2N3O6 and a molecular weight of 511.48 g/mol. Its IUPAC name is 2-[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 16583793 |
| Molecular Formula | C26H23F2N3O6 |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 2-[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)NC(=O)N(CC(=O)Nc3ccc(OC(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H23F2N3O6/c1-35-19-9-3-16(4-10-19)26(17-5-11-20(36-2)12-6-17)23(33)31(25(34)30-26)15-22(32)29-18-7-13-21(14-8-18)37-24(27)28/h3-14,24H,15H2,1-2H3,(H,29,32)(H,30,34) |
| InChIKey | CFHITMNSFPTLNN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|