About [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate
[1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate (PubChem CID 16584229) has the molecular formula C24H26N4O2
and a molecular weight of 402.50 g/mol. Its IUPAC name is [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate.
Molecular Properties
| Compound Name | [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate |
| PubChem CID | 16584229 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1cc(-c2ccccc2)nn1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H26N4O2/c1-3-5-11-17(4-2)23(29)30-22-16-21(18-12-7-6-8-13-18)27-28(22)24-25-19-14-9-10-15-20(19)26-24/h6-10,12-17H,3-5,11H2,1-2H3,(H,25,26) |
| InChIKey | XYJHNPRQVRDXGY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate?
The IUPAC name of [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate (CID 16584229) is [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate.
What is the SMILES notation for [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate?
The canonical SMILES for [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate is CCCCC(CC)C(=O)Oc1cc(-c2ccccc2)nn1-c1nc2ccccc2[nH]1.
What is the InChIKey of [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate?
The InChIKey is XYJHNPRQVRDXGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N4O2/c1-3-5-11-17(4-2)23(29)30-22-16-21(18-12-7-6-8-13-18)27-28(22)24-25-19-14-9-10-15-20(19)26-24/h6-10,12-17H,3-5,11H2,1-2H3,(H,25,26).
What are the key properties of [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate?
[1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate has a molecular weight of 402.50 g/mol, XLogP of 5.54, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1H-benzimidazol-2-yl)-3-phenylpyrazol-5-yl] 2-ethylhexanoate is sourced from PubChem (CID 16584229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).