C18H19N5O2 — CID 16584499
1-[2-[(8-ethoxy-4-methylquinazolin-2-yl)amino]-4-methylpyrimidin-5-yl]ethanone (PubChem CID 16584499) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1-[2-[(8-ethoxy-4-methylquinazolin-2-yl)amino]-4-methylpyrimidin-5-yl]ethanone.
| Compound Name | 1-[2-[(8-ethoxy-4-methylquinazolin-2-yl)amino]-4-methylpyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 16584499 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-[2-[(8-ethoxy-4-methylquinazolin-2-yl)amino]-4-methylpyrimidin-5-yl]ethanone |
| SMILES | CCOc1cccc2c(C)nc(Nc3ncc(C(C)=O)c(C)n3)nc12 |
| InChI | InChI=1S/C18H19N5O2/c1-5-25-15-8-6-7-13-10(2)21-18(22-16(13)15)23-17-19-9-14(12(4)24)11(3)20-17/h6-9H,5H2,1-4H3,(H,19,20,21,22,23) |
| InChIKey | GOYJTXMZDRMJQX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |