About N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide
N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide (PubChem CID 16584756) has the molecular formula C23H18ClN3O3
and a molecular weight of 419.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide |
| PubChem CID | 16584756 |
| Molecular Formula | C23H18ClN3O3 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide |
| SMILES | CN1C(=O)C2(OCc3ccccc3N2C(=O)Nc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C23H18ClN3O3/c1-26-20-9-5-3-7-18(20)23(21(26)28)27(19-8-4-2-6-15(19)14-30-23)22(29)25-17-12-10-16(24)11-13-17/h2-13H,14H2,1H3,(H,25,29) |
| InChIKey | KMHDUJMXBAYDMJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide?
The IUPAC name of N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide (CID 16584756) is N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide.
What is the SMILES notation for N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide?
The canonical SMILES for N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide is CN1C(=O)C2(OCc3ccccc3N2C(=O)Nc2ccc(Cl)cc2)c2ccccc21.
What is the InChIKey of N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide?
The InChIKey is KMHDUJMXBAYDMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18ClN3O3/c1-26-20-9-5-3-7-18(20)23(21(26)28)27(19-8-4-2-6-15(19)14-30-23)22(29)25-17-12-10-16(24)11-13-17/h2-13H,14H2,1H3,(H,25,29).
What are the key properties of N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide?
N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide has a molecular weight of 419.87 g/mol, XLogP of 4.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-1'-methyl-2'-oxospiro[4H-3,1-benzoxazine-2,3'-indole]-1-carboxamide is sourced from PubChem (CID 16584756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).