About 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one
1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one (PubChem CID 16584781) has the molecular formula C25H19FN2O3
and a molecular weight of 414.44 g/mol. Its IUPAC name is 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one |
| PubChem CID | 16584781 |
| Molecular Formula | C25H19FN2O3 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one |
| SMILES | C=CCN1C(=O)C2(OCc3ccccc3N2C(=O)c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C25H19FN2O3/c1-2-15-27-22-14-8-5-11-19(22)25(24(27)30)28(21-13-7-3-9-17(21)16-31-25)23(29)18-10-4-6-12-20(18)26/h2-14H,1,15-16H2 |
| InChIKey | SSGVMTIOHYHHJC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one?
The IUPAC name of 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one (CID 16584781) is 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one.
What is the SMILES notation for 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one?
The canonical SMILES for 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one is C=CCN1C(=O)C2(OCc3ccccc3N2C(=O)c2ccccc2F)c2ccccc21.
What is the InChIKey of 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one?
The InChIKey is SSGVMTIOHYHHJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19FN2O3/c1-2-15-27-22-14-8-5-11-19(22)25(24(27)30)28(21-13-7-3-9-17(21)16-31-25)23(29)18-10-4-6-12-20(18)26/h2-14H,1,15-16H2.
What are the key properties of 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one?
1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one has a molecular weight of 414.44 g/mol, XLogP of 4.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorobenzoyl)-1'-prop-2-enylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one is sourced from PubChem (CID 16584781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).