About 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline
3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline (PubChem CID 16584874) has the molecular formula C19H18N4O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline.
Molecular Properties
| Compound Name | 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline |
| PubChem CID | 16584874 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline |
| SMILES | COc1cc2nnc3c(c(C)nn3Cc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C19H18N4O2/c1-12-18-14-9-16(24-2)17(25-3)10-15(14)20-21-19(18)23(22-12)11-13-7-5-4-6-8-13/h4-10H,11H2,1-3H3 |
| InChIKey | WHXIYNOTWUHLCR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline?
The IUPAC name of 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline (CID 16584874) is 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline.
What is the SMILES notation for 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline?
The canonical SMILES for 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline is COc1cc2nnc3c(c(C)nn3Cc3ccccc3)c2cc1OC.
What is the InChIKey of 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline?
The InChIKey is WHXIYNOTWUHLCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O2/c1-12-18-14-9-16(24-2)17(25-3)10-15(14)20-21-19(18)23(22-12)11-13-7-5-4-6-8-13/h4-10H,11H2,1-3H3.
What are the key properties of 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline?
3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline has a molecular weight of 334.38 g/mol, XLogP of 3.35, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-7,8-dimethoxy-1-methylpyrazolo[5,4-c]cinnoline is sourced from PubChem (CID 16584874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).