C27H26N2O5 — CID 16585292
methyl 4,7-dioxo-6-(4-phenylmethoxyphenyl)-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate (PubChem CID 16585292) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is methyl 4,7-dioxo-6-(4-phenylmethoxyphenyl)-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate.
| Compound Name | methyl 4,7-dioxo-6-(4-phenylmethoxyphenyl)-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate |
|---|---|
| PubChem CID | 16585292 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | methyl 4,7-dioxo-6-(4-phenylmethoxyphenyl)-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate |
| SMILES | COC(=O)C1=C2C(=O)NCCN2C2=C(C(=O)CCC2)C1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O5/c1-33-27(32)24-22(18-10-12-19(13-11-18)34-16-17-6-3-2-4-7-17)23-20(8-5-9-21(23)30)29-15-14-28-26(31)25(24)29/h2-4,6-7,10-13,22H,5,8-9,14-16H2,1H3,(H,28,31) |
| InChIKey | OYIGQENACMOOBV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |