C18H22IN5OS — CID 16586307
2-[(4-cyclopropyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 16586307) has the molecular formula C18H22IN5OS and a molecular weight of 483.38 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-[(4-cyclopropyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16586307 |
| Molecular Formula | C18H22IN5OS |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 2-[(4-cyclopropyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CSc1nnc(N2CCCC2)n1C1CC1 |
| InChI | InChI=1S/C18H22IN5OS/c1-12-10-13(19)4-7-15(12)20-16(25)11-26-18-22-21-17(23-8-2-3-9-23)24(18)14-5-6-14/h4,7,10,14H,2-3,5-6,8-9,11H2,1H3,(H,20,25) |
| InChIKey | JLLWNUZCMJZYID-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|