C23H25N7OS — CID 16586313
2-[(4-cyclopropyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide (PubChem CID 16586313) has the molecular formula C23H25N7OS and a molecular weight of 447.57 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide.
| Compound Name | 2-[(4-cyclopropyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide |
|---|---|
| PubChem CID | 16586313 |
| Molecular Formula | C23H25N7OS |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2-[(4-cyclopropyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide |
| SMILES | O=C(CSc1nnc(N2CCCC2)n1C1CC1)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N7OS/c31-21(24-17-8-10-19(11-9-17)26-25-18-6-2-1-3-7-18)16-32-23-28-27-22(29-14-4-5-15-29)30(23)20-12-13-20/h1-3,6-11,20H,4-5,12-16H2,(H,24,31)/b26-25+ |
| InChIKey | OKAHWMCNQWLFTH-OCEACIFDSA-N |
| XLogP | 5.36 |
| TPSA | 87.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|