C23H24BrN3O3 — CID 16589755
N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-5-bromo-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 16589755) has the molecular formula C23H24BrN3O3 and a molecular weight of 470.37 g/mol. Its IUPAC name is N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-5-bromo-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-5-bromo-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 16589755 |
| Molecular Formula | C23H24BrN3O3 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-5-bromo-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NC2CCN(CC(=O)Nc3ccccc3)CC2)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C23H24BrN3O3/c1-15-19-13-16(24)7-8-20(19)30-22(15)23(29)26-18-9-11-27(12-10-18)14-21(28)25-17-5-3-2-4-6-17/h2-8,13,18H,9-12,14H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | RIUKKZFNZNHIBI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |