C24H30N4O5S — CID 16589804
N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 16589804) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 16589804 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(CN1CCC(NC(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C24H30N4O5S/c29-23(25-20-6-2-1-3-7-20)18-27-11-9-21(10-12-27)26-24(30)19-5-4-8-22(17-19)34(31,32)28-13-15-33-16-14-28/h1-8,17,21H,9-16,18H2,(H,25,29)(H,26,30) |
| InChIKey | XGYLIJGSZBKHFJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |