C19H17FN2O2 — CID 16590316
3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methylphenyl)propanamide (PubChem CID 16590316) has the molecular formula C19H17FN2O2 and a molecular weight of 324.36 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methylphenyl)propanamide.
| Compound Name | 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 16590316 |
| Molecular Formula | C19H17FN2O2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1NC(=O)CCc1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C19H17FN2O2/c1-13-4-2-3-5-16(13)22-18(23)10-11-19-21-12-17(24-19)14-6-8-15(20)9-7-14/h2-9,12H,10-11H2,1H3,(H,22,23) |
| InChIKey | UVLZGIJXPWMINK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |