About (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate
(4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate (PubChem CID 16591321) has the molecular formula C26H24N2O4
and a molecular weight of 428.49 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
| PubChem CID | 16591321 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
| SMILES | O=C(Oc1ccc(OCc2ccccc2)cc1)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C26H24N2O4/c29-25(31-22-12-10-21(11-13-22)30-18-19-6-2-1-3-7-19)20-14-16-28(17-15-20)26-27-23-8-4-5-9-24(23)32-26/h1-13,20H,14-18H2 |
| InChIKey | VKDVZGAGNVSYQN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The IUPAC name of (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate (CID 16591321) is (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate.
What is the SMILES notation for (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The canonical SMILES for (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate is O=C(Oc1ccc(OCc2ccccc2)cc1)C1CCN(c2nc3ccccc3o2)CC1.
What is the InChIKey of (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The InChIKey is VKDVZGAGNVSYQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O4/c29-25(31-22-12-10-21(11-13-22)30-18-19-6-2-1-3-7-19)20-14-16-28(17-15-20)26-27-23-8-4-5-9-24(23)32-26/h1-13,20H,14-18H2.
What are the key properties of (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
(4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate has a molecular weight of 428.49 g/mol, XLogP of 5.23, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylmethoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate is sourced from PubChem (CID 16591321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).