C26H22N4O5 — CID 16591424
[2-[(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 16591424) has the molecular formula C26H22N4O5 and a molecular weight of 470.49 g/mol. Its IUPAC name is [2-[(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 16591424 |
| Molecular Formula | C26H22N4O5 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | [2-[(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1c(C#N)c(NC(=O)COC(=O)CCN2C(=O)c3ccccc3C2=O)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C26H22N4O5/c1-16-17(2)30(18-8-4-3-5-9-18)24(21(16)14-27)28-22(31)15-35-23(32)12-13-29-25(33)19-10-6-7-11-20(19)26(29)34/h3-11H,12-13,15H2,1-2H3,(H,28,31) |
| InChIKey | SJQKFWOXVZBLGO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|