C21H20N2O3S — CID 16592622
N-(2-acetylphenyl)-2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 16592622) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(2-acetylphenyl)-2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 16592622 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-(2-acetylphenyl)-2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCOc1ccccc1-c1nc(CC(=O)Nc2ccccc2C(C)=O)cs1 |
| InChI | InChI=1S/C21H20N2O3S/c1-3-26-19-11-7-5-9-17(19)21-22-15(13-27-21)12-20(25)23-18-10-6-4-8-16(18)14(2)24/h4-11,13H,3,12H2,1-2H3,(H,23,25) |
| InChIKey | ZOBNVLKAUZLQPE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |