About (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate
(4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate (PubChem CID 16594826) has the molecular formula C22H22N2O5
and a molecular weight of 394.43 g/mol. Its IUPAC name is (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
| PubChem CID | 16594826 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
| SMILES | COc1cc(C(C)=O)ccc1OC(=O)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C22H22N2O5/c1-14(25)16-7-8-19(20(13-16)27-2)28-21(26)15-9-11-24(12-10-15)22-23-17-5-3-4-6-18(17)29-22/h3-8,13,15H,9-12H2,1-2H3 |
| InChIKey | JNUSDWZADYOSOA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The IUPAC name of (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate (CID 16594826) is (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate.
What is the SMILES notation for (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The canonical SMILES for (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate is COc1cc(C(C)=O)ccc1OC(=O)C1CCN(c2nc3ccccc3o2)CC1.
What is the InChIKey of (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The InChIKey is JNUSDWZADYOSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O5/c1-14(25)16-7-8-19(20(13-16)27-2)28-21(26)15-9-11-24(12-10-15)22-23-17-5-3-4-6-18(17)29-22/h3-8,13,15H,9-12H2,1-2H3.
What are the key properties of (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
(4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate has a molecular weight of 394.43 g/mol, XLogP of 3.86, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyl-2-methoxyphenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate is sourced from PubChem (CID 16594826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).