C19H18Cl2N2O5 — CID 16595160
[2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 16595160) has the molecular formula C19H18Cl2N2O5 and a molecular weight of 425.27 g/mol. Its IUPAC name is [2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 16595160 |
| Molecular Formula | C19H18Cl2N2O5 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | [2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | Nc1c(Cl)cc(Cl)cc1C(=O)OCC(=O)NCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H18Cl2N2O5/c20-12-8-13(18(22)14(21)9-12)19(25)28-10-17(24)23-4-3-11-1-2-15-16(7-11)27-6-5-26-15/h1-2,7-9H,3-6,10,22H2,(H,23,24) |
| InChIKey | OTDDCPXTVYDTLC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|