C16H10BrClN2O3 — CID 16595326
5-bromo-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde (PubChem CID 16595326) has the molecular formula C16H10BrClN2O3 and a molecular weight of 393.62 g/mol. Its IUPAC name is 5-bromo-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde.
| Compound Name | 5-bromo-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 16595326 |
| Molecular Formula | C16H10BrClN2O3 |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 5-bromo-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzaldehyde |
| SMILES | O=Cc1cc(Br)ccc1OCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C16H10BrClN2O3/c17-12-3-6-14(11(7-12)8-21)22-9-15-19-16(20-23-15)10-1-4-13(18)5-2-10/h1-8H,9H2 |
| InChIKey | CAYZEONZNWJGPF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|