C12H10N2O5 — CID 16595378
[2-(1,2-oxazol-3-ylamino)-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 16595378) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 16595378 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccco1)Nc1ccon1 |
| InChI | InChI=1S/C12H10N2O5/c15-11(13-10-5-7-19-14-10)8-18-12(16)4-3-9-2-1-6-17-9/h1-7H,8H2,(H,13,14,15)/b4-3+ |
| InChIKey | ICFPPZMWMLLITK-ONEGZZNKSA-N |
| XLogP | 1.46 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|