C23H20N2O5 — CID 16596540
(2-amino-2-oxo-1-phenylethyl) 2-[(4-phenoxybenzoyl)amino]acetate (PubChem CID 16596540) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) 2-[(4-phenoxybenzoyl)amino]acetate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) 2-[(4-phenoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 16596540 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) 2-[(4-phenoxybenzoyl)amino]acetate |
| SMILES | NC(=O)C(OC(=O)CNC(=O)c1ccc(Oc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O5/c24-22(27)21(16-7-3-1-4-8-16)30-20(26)15-25-23(28)17-11-13-19(14-12-17)29-18-9-5-2-6-10-18/h1-14,21H,15H2,(H2,24,27)(H,25,28) |
| InChIKey | HPZDTCCIFBVDLE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |