C16H13BrClN3OS — CID 16596863
N-[(5-bromothiophen-2-yl)methyl]-5-(4-chlorophenyl)-N-methyl-1H-pyrazole-4-carboxamide (PubChem CID 16596863) has the molecular formula C16H13BrClN3OS and a molecular weight of 410.72 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-5-(4-chlorophenyl)-N-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-5-(4-chlorophenyl)-N-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 16596863 |
| Molecular Formula | C16H13BrClN3OS |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-5-(4-chlorophenyl)-N-methyl-1H-pyrazole-4-carboxamide |
| SMILES | CN(Cc1ccc(Br)s1)C(=O)c1cn[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13BrClN3OS/c1-21(9-12-6-7-14(17)23-12)16(22)13-8-19-20-15(13)10-2-4-11(18)5-3-10/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | YTAMFQKUHKQUMG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |