About 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile
4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile (PubChem CID 166000107) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile |
| PubChem CID | 166000107 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile |
| SMILES | N#CC1=C(N)CCN(C2CC2)C1 |
| InChI | InChI=1S/C9H13N3/c10-5-7-6-12(8-1-2-8)4-3-9(7)11/h8H,1-4,6,11H2 |
| InChIKey | NECQZZVLVPWGKV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile?
The IUPAC name of 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile (CID 166000107) is 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile.
What is the SMILES notation for 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile?
The canonical SMILES for 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile is N#CC1=C(N)CCN(C2CC2)C1.
What is the InChIKey of 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile?
The InChIKey is NECQZZVLVPWGKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c10-5-7-6-12(8-1-2-8)4-3-9(7)11/h8H,1-4,6,11H2.
What are the key properties of 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile?
4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile has a molecular weight of 163.22 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-cyclopropyl-3,6-dihydro-2H-pyridine-5-carbonitrile is sourced from PubChem (CID 166000107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).