methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate

C12H14F2O4 — CID 166001159

IUPACmethyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate
SMILESCOC(=O)c1cc(C(C)O)ccc1OCC(F)F
InChIInChI=1S/C12H14F2O4/c1-7(15)8-3-4-10(18-6-11(13)14)9(5-8)12(16)17-2/h3-5,7,11,15H,6H2,1-2H3
InChIKeyGJXDREVPOVBTBE-UHFFFAOYSA-N
MW260.24 g/mol
LogP2.17
Rot. Bonds5

About methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate

methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate (PubChem CID 166001159) has the molecular formula C12H14F2O4 and a molecular weight of 260.24 g/mol. Its IUPAC name is methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate.

Molecular Properties

Compound Namemethyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate
PubChem CID166001159
Molecular FormulaC12H14F2O4
Molecular Weight260.24 g/mol
Exact Mass260.09
IUPAC Namemethyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate
SMILESCOC(=O)c1cc(C(C)O)ccc1OCC(F)F
InChIInChI=1S/C12H14F2O4/c1-7(15)8-3-4-10(18-6-11(13)14)9(5-8)12(16)17-2/h3-5,7,11,15H,6H2,1-2H3
InChIKeyGJXDREVPOVBTBE-UHFFFAOYSA-N
XLogP2.17
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.24
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate?
The IUPAC name of methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate (CID 166001159) is methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate.
What is the SMILES notation for methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate?
The canonical SMILES for methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate is COC(=O)c1cc(C(C)O)ccc1OCC(F)F.
What is the InChIKey of methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate?
The InChIKey is GJXDREVPOVBTBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O4/c1-7(15)8-3-4-10(18-6-11(13)14)9(5-8)12(16)17-2/h3-5,7,11,15H,6H2,1-2H3.
What are the key properties of methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate?
methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate has a molecular weight of 260.24 g/mol, XLogP of 2.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,2-difluoroethoxy)-5-(1-hydroxyethyl)benzoate is sourced from PubChem (CID 166001159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).