C12H20ClNO2S — CID 166001464
4-(3,5-dimethylphenyl)sulfonylbutan-1-amine;hydrochloride (PubChem CID 166001464) has the molecular formula C12H20ClNO2S and a molecular weight of 277.82 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)sulfonylbutan-1-amine;hydrochloride.
| Compound Name | 4-(3,5-dimethylphenyl)sulfonylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 166001464 |
| Molecular Formula | C12H20ClNO2S |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-(3,5-dimethylphenyl)sulfonylbutan-1-amine;hydrochloride |
| SMILES | Cc1cc(C)cc(S(=O)(=O)CCCCN)c1.Cl |
| InChI | InChI=1S/C12H19NO2S.ClH/c1-10-7-11(2)9-12(8-10)16(14,15)6-4-3-5-13;/h7-9H,3-6,13H2,1-2H3;1H |
| InChIKey | YQFVMKRMDAENGX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|