C12H12N4O2 — CID 166001570
1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3,5,7-triene-11,15-dione (PubChem CID 166001570) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3,5,7-triene-11,15-dione.
| Compound Name | 1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3,5,7-triene-11,15-dione |
|---|---|
| PubChem CID | 166001570 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3,5,7-triene-11,15-dione |
| SMILES | O=C1NC2NC(=O)N3Cc4ccccc4CN1C23 |
| InChI | InChI=1S/C12H12N4O2/c17-11-13-9-10-15(11)5-7-3-1-2-4-8(7)6-16(10)12(18)14-9/h1-4,9-10H,5-6H2,(H,13,17)(H,14,18) |
| InChIKey | ZVCGYNOYTAZNMB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |