C60H41N3O — CID 166002481
2-[8-[4-(9,9-dimethylfluoren-1-yl)phenyl]dibenzofuran-1-yl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 166002481) has the molecular formula C60H41N3O and a molecular weight of 820.01 g/mol. Its IUPAC name is 2-[8-[4-(9,9-dimethylfluoren-1-yl)phenyl]dibenzofuran-1-yl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[8-[4-(9,9-dimethylfluoren-1-yl)phenyl]dibenzofuran-1-yl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 166002481 |
| Molecular Formula | C60H41N3O |
| Molecular Weight | 820.01 g/mol |
| Exact Mass | 819.32 |
| IUPAC Name | 2-[8-[4-(9,9-dimethylfluoren-1-yl)phenyl]dibenzofuran-1-yl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cccc(-c3ccc(-c4ccc5oc6cccc(-c7nc(-c8ccc(-c9ccccc9)cc8)nc(-c8ccc(-c9ccccc9)cc8)n7)c6c5c4)cc3)c21 |
| InChI | InChI=1S/C60H41N3O/c1-60(2)52-21-10-9-17-48(52)49-19-11-18-47(56(49)60)43-29-23-42(24-30-43)46-35-36-53-51(37-46)55-50(20-12-22-54(55)64-53)59-62-57(44-31-25-40(26-32-44)38-13-5-3-6-14-38)61-58(63-59)45-33-27-41(28-34-45)39-15-7-4-8-16-39/h3-37H,1-2H3 |
| InChIKey | CCEKRIISGNNCEO-UHFFFAOYSA-N |
| XLogP | 15.75 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.01 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |