C24H25FN4O2 — CID 166003226
1-[8-(5-fluoro-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-3-(quinolin-5-ylmethoxy)propan-1-one (PubChem CID 166003226) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-[8-(5-fluoro-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-3-(quinolin-5-ylmethoxy)propan-1-one.
| Compound Name | 1-[8-(5-fluoro-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-3-(quinolin-5-ylmethoxy)propan-1-one |
|---|---|
| PubChem CID | 166003226 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 1-[8-(5-fluoro-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-3-(quinolin-5-ylmethoxy)propan-1-one |
| SMILES | O=C(CCOCc1cccc2ncccc12)N1CC2CCC(C1)N2c1ccc(F)cn1 |
| InChI | InChI=1S/C24H25FN4O2/c25-18-6-9-23(27-13-18)29-19-7-8-20(29)15-28(14-19)24(30)10-12-31-16-17-3-1-5-22-21(17)4-2-11-26-22/h1-6,9,11,13,19-20H,7-8,10,12,14-16H2 |
| InChIKey | ZZEWHLNMOBFLTR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|