C10H12IN3OS — CID 166003394
1-(5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)cyclopentan-1-ol (PubChem CID 166003394) has the molecular formula C10H12IN3OS and a molecular weight of 349.20 g/mol. Its IUPAC name is 1-(5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)cyclopentan-1-ol.
| Compound Name | 1-(5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 166003394 |
| Molecular Formula | C10H12IN3OS |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 1-(5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)cyclopentan-1-ol |
| SMILES | Cc1nc2sc(C3(O)CCCC3)nn2c1I |
| InChI | InChI=1S/C10H12IN3OS/c1-6-7(11)14-9(12-6)16-8(13-14)10(15)4-2-3-5-10/h15H,2-5H2,1H3 |
| InChIKey | WCWKXDMQGIUHEF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|