C10H10F3N3 — CID 166003644
(2Z,4E)-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]hexa-2,4-dien-1-imine (PubChem CID 166003644) has the molecular formula C10H10F3N3 and a molecular weight of 229.21 g/mol. Its IUPAC name is (2Z,4E)-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]hexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 166003644 |
| Molecular Formula | C10H10F3N3 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | (2Z,4E)-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]hexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C\C=C(/C)c1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C10H10F3N3/c1-7(4-2-3-5-14)8-6-9(16-15-8)10(11,12)13/h2-6,14H,1H3,(H,15,16)/b3-2-,7-4+,14-5+ |
| InChIKey | FTWJHVPSGCLEDZ-FHQQORGDSA-N |
| XLogP | 3.04 |
| TPSA | 52.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|