C18H21F4N3O4S2 — CID 166003728
N-[(5S)-3-(cyclopropylmethylsulfamoyl)-5-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-fluorocyclopropane-1-carboxamide (PubChem CID 166003728) has the molecular formula C18H21F4N3O4S2 and a molecular weight of 483.51 g/mol. Its IUPAC name is N-[(5S)-3-(cyclopropylmethylsulfamoyl)-5-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-fluorocyclopropane-1-carboxamide.
| Compound Name | N-[(5S)-3-(cyclopropylmethylsulfamoyl)-5-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 166003728 |
| Molecular Formula | C18H21F4N3O4S2 |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | N-[(5S)-3-(cyclopropylmethylsulfamoyl)-5-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-fluorocyclopropane-1-carboxamide |
| SMILES | O=C(Nc1sc2c(c1S(=O)(=O)NCC1CC1)C[C@@H](NC(=O)C(F)(F)F)CC2)C1CC1F |
| InChI | InChI=1S/C18H21F4N3O4S2/c19-12-6-10(12)15(26)25-16-14(31(28,29)23-7-8-1-2-8)11-5-9(3-4-13(11)30-16)24-17(27)18(20,21)22/h8-10,12,23H,1-7H2,(H,24,27)(H,25,26)/t9-,10?,12?/m0/s1 |
| InChIKey | NPCHASJIMLWJMP-BMQDGWLCSA-N |
| XLogP | 2.27 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |