About [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate
[2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate (PubChem CID 166004474) has the molecular formula C12H10F6N2O3
and a molecular weight of 344.21 g/mol. Its IUPAC name is [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate |
| PubChem CID | 166004474 |
| Molecular Formula | C12H10F6N2O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cc(C(F)(F)F)cnc1OC1CCNC1)C(F)(F)F |
| InChI | InChI=1S/C12H10F6N2O3/c13-11(14,15)6-3-8(23-10(21)12(16,17)18)9(20-4-6)22-7-1-2-19-5-7/h3-4,7,19H,1-2,5H2 |
| InChIKey | QJYDRAVFJPCZTQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate?
The IUPAC name of [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate (CID 166004474) is [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate.
What is the SMILES notation for [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate?
The canonical SMILES for [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate is O=C(Oc1cc(C(F)(F)F)cnc1OC1CCNC1)C(F)(F)F.
What is the InChIKey of [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate?
The InChIKey is QJYDRAVFJPCZTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F6N2O3/c13-11(14,15)6-3-8(23-10(21)12(16,17)18)9(20-4-6)22-7-1-2-19-5-7/h3-4,7,19H,1-2,5H2.
What are the key properties of [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate?
[2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate has a molecular weight of 344.21 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-pyrrolidin-3-yloxy-5-(trifluoromethyl)-3-pyridinyl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 166004474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).