C15H23NO4 — CID 166004699
4-[2-(4-methylphenoxy)ethoxy]butyl N-methylcarbamate (PubChem CID 166004699) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-[2-(4-methylphenoxy)ethoxy]butyl N-methylcarbamate.
| Compound Name | 4-[2-(4-methylphenoxy)ethoxy]butyl N-methylcarbamate |
|---|---|
| PubChem CID | 166004699 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-[2-(4-methylphenoxy)ethoxy]butyl N-methylcarbamate |
| SMILES | CNC(=O)OCCCCOCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C15H23NO4/c1-13-5-7-14(8-6-13)19-12-11-18-9-3-4-10-20-15(17)16-2/h5-8H,3-4,9-12H2,1-2H3,(H,16,17) |
| InChIKey | KMPUYVKWCUBKLD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|