C21H23N3O7 — CID 166005006
2-[4-(3,4-dihydroxybenzoyl)piperazin-1-yl]-N-(6-methoxy-1,3-benzodioxol-5-yl)acetamide (PubChem CID 166005006) has the molecular formula C21H23N3O7 and a molecular weight of 429.43 g/mol. Its IUPAC name is 2-[4-(3,4-dihydroxybenzoyl)piperazin-1-yl]-N-(6-methoxy-1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-[4-(3,4-dihydroxybenzoyl)piperazin-1-yl]-N-(6-methoxy-1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 166005006 |
| Molecular Formula | C21H23N3O7 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-[4-(3,4-dihydroxybenzoyl)piperazin-1-yl]-N-(6-methoxy-1,3-benzodioxol-5-yl)acetamide |
| SMILES | COc1cc2c(cc1NC(=O)CN1CCN(C(=O)c3ccc(O)c(O)c3)CC1)OCO2 |
| InChI | InChI=1S/C21H23N3O7/c1-29-17-10-19-18(30-12-31-19)9-14(17)22-20(27)11-23-4-6-24(7-5-23)21(28)13-2-3-15(25)16(26)8-13/h2-3,8-10,25-26H,4-7,11-12H2,1H3,(H,22,27) |
| InChIKey | PVFMMJSMIFMKAX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|