About (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid
(2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid (PubChem CID 166005390) has the molecular formula C18H23NO5
and a molecular weight of 333.38 g/mol. Its IUPAC name is (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid.
Molecular Properties
| Compound Name | (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid |
| PubChem CID | 166005390 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid |
| SMILES | CN(C(=O)O[C@H]1/C=C\CCCCC1)c1ccc([C@@H](O)C(=O)O)cc1 |
| InChI | InChI=1S/C18H23NO5/c1-19(14-11-9-13(10-12-14)16(20)17(21)22)18(23)24-15-7-5-3-2-4-6-8-15/h5,7,9-12,15-16,20H,2-4,6,8H2,1H3,(H,21,22)/b7-5-/t15-,16+/m0/s1 |
| InChIKey | DFGBTBRTUATLLU-JKWYKVDLSA-N |
| XLogP | 3.27 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid?
The IUPAC name of (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid (CID 166005390) is (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid.
What is the SMILES notation for (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid?
The canonical SMILES for (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid is CN(C(=O)O[C@H]1/C=C\CCCCC1)c1ccc([C@@H](O)C(=O)O)cc1.
What is the InChIKey of (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid?
The InChIKey is DFGBTBRTUATLLU-JKWYKVDLSA-N. The full InChI is InChI=1S/C18H23NO5/c1-19(14-11-9-13(10-12-14)16(20)17(21)22)18(23)24-15-7-5-3-2-4-6-8-15/h5,7,9-12,15-16,20H,2-4,6,8H2,1H3,(H,21,22)/b7-5-/t15-,16+/m0/s1.
What are the key properties of (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid?
(2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid has a molecular weight of 333.38 g/mol, XLogP of 3.27, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[4-[[(1R,2E)-cyclooct-2-en-1-yl]oxycarbonyl-methylamino]phenyl]-2-hydroxyacetic acid is sourced from PubChem (CID 166005390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).