C17H12F3N2O2S+ — CID 166006238
N-(1,3-thiazol-3-ium-3-yl)-4-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 166006238) has the molecular formula C17H12F3N2O2S+ and a molecular weight of 365.36 g/mol. Its IUPAC name is N-(1,3-thiazol-3-ium-3-yl)-4-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | N-(1,3-thiazol-3-ium-3-yl)-4-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 166006238 |
| Molecular Formula | C17H12F3N2O2S+ |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-(1,3-thiazol-3-ium-3-yl)-4-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | O=C(N[n+]1ccsc1)c1ccc(-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H11F3N2O2S/c18-17(19,20)24-15-7-5-13(6-8-15)12-1-3-14(4-2-12)16(23)21-22-9-10-25-11-22/h1-11H/p+1 |
| InChIKey | QLCGTMLBRAZBBQ-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|