C18H13F6N4O2+ — CID 166006250
3,5-difluoro-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide (PubChem CID 166006250) has the molecular formula C18H13F6N4O2+ and a molecular weight of 431.32 g/mol. Its IUPAC name is 3,5-difluoro-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide.
| Compound Name | 3,5-difluoro-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 166006250 |
| Molecular Formula | C18H13F6N4O2+ |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 3,5-difluoro-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
| SMILES | Cn1c[n+](NC(=O)c2cc(F)c(-c3ccc(OC(F)(F)C(F)F)cc3)c(F)c2)cn1 |
| InChI | InChI=1S/C18H12F6N4O2/c1-27-9-28(8-25-27)26-16(29)11-6-13(19)15(14(20)7-11)10-2-4-12(5-3-10)30-18(23,24)17(21)22/h2-9,17H,1H3/p+1 |
| InChIKey | AKOWSOJDTWETQR-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|