C19H15F6N4O2+ — CID 166006308
N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-3,5-difluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide (PubChem CID 166006308) has the molecular formula C19H15F6N4O2+ and a molecular weight of 445.34 g/mol. Its IUPAC name is N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-3,5-difluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide.
| Compound Name | N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-3,5-difluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 166006308 |
| Molecular Formula | C19H15F6N4O2+ |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-3,5-difluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
| SMILES | CCn1c[n+](NC(=O)c2cc(F)c(-c3ccc(OC(F)(F)C(F)F)cc3)c(F)c2)cn1 |
| InChI | InChI=1S/C19H14F6N4O2/c1-2-28-10-29(9-26-28)27-17(30)12-7-14(20)16(15(21)8-12)11-3-5-13(6-4-11)31-19(24,25)18(22)23/h3-10,18H,2H2,1H3/p+1 |
| InChIKey | FTCXFLQWENTPFD-UHFFFAOYSA-O |
| XLogP | 3.76 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|