C35H39Cl2OTi- — CID 166006366
2-tert-butyl-6-[2-(3,4-diphenylcyclopentyl)phenyl]-4-methylphenol;carbanide;dichlorotitanium (PubChem CID 166006366) has the molecular formula C35H39Cl2OTi- and a molecular weight of 594.47 g/mol. Its IUPAC name is 2-tert-butyl-6-[2-(3,4-diphenylcyclopentyl)phenyl]-4-methylphenol;carbanide;dichlorotitanium.
| Compound Name | 2-tert-butyl-6-[2-(3,4-diphenylcyclopentyl)phenyl]-4-methylphenol;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 166006366 |
| Molecular Formula | C35H39Cl2OTi- |
| Molecular Weight | 594.47 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | 2-tert-butyl-6-[2-(3,4-diphenylcyclopentyl)phenyl]-4-methylphenol;carbanide;dichlorotitanium |
| SMILES | Cc1cc(-c2ccccc2C2CC(c3ccccc3)C(c3ccccc3)C2)c(O)c(C(C)(C)C)c1.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C34H36O.CH3.2ClH.Ti/c1-23-19-31(33(35)32(20-23)34(2,3)4)28-18-12-11-17-27(28)26-21-29(24-13-7-5-8-14-24)30(22-26)25-15-9-6-10-16-25;;;;/h5-20,26,29-30,35H,21-22H2,1-4H3;1H3;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | KZMAYUUPBIPIOV-UHFFFAOYSA-L |
| XLogP | 10.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.47 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|