About [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate
[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate (PubChem CID 166008553) has the molecular formula C23H23F3N2O3
and a molecular weight of 432.44 g/mol. Its IUPAC name is [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate.
Molecular Properties
| Compound Name | [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate |
| PubChem CID | 166008553 |
| Molecular Formula | C23H23F3N2O3 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate |
| SMILES | COCC(C)NC(=O)OC1CC(c2c(-c3ccc(F)cc3)[nH]c3c(F)cc(F)cc23)C1 |
| InChI | InChI=1S/C23H23F3N2O3/c1-12(11-30-2)27-23(29)31-17-7-14(8-17)20-18-9-16(25)10-19(26)22(18)28-21(20)13-3-5-15(24)6-4-13/h3-6,9-10,12,14,17,28H,7-8,11H2,1-2H3,(H,27,29) |
| InChIKey | ZOMGBFDQYVJIIB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate?
The IUPAC name of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate (CID 166008553) is [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate.
What is the SMILES notation for [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate?
The canonical SMILES for [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate is COCC(C)NC(=O)OC1CC(c2c(-c3ccc(F)cc3)[nH]c3c(F)cc(F)cc23)C1.
What is the InChIKey of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate?
The InChIKey is ZOMGBFDQYVJIIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23F3N2O3/c1-12(11-30-2)27-23(29)31-17-7-14(8-17)20-18-9-16(25)10-19(26)22(18)28-21(20)13-3-5-15(24)6-4-13/h3-6,9-10,12,14,17,28H,7-8,11H2,1-2H3,(H,27,29).
What are the key properties of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate?
[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate has a molecular weight of 432.44 g/mol, XLogP of 5.26, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-methoxypropan-2-yl)carbamate is sourced from PubChem (CID 166008553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).