About [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate
[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate (PubChem CID 166008615) has the molecular formula C22H21F3N2O3
and a molecular weight of 418.42 g/mol. Its IUPAC name is [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate.
Molecular Properties
| Compound Name | [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate |
| PubChem CID | 166008615 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate |
| SMILES | CC(CO)NC(=O)OC1CC(c2c(-c3ccc(F)cc3)[nH]c3c(F)cc(F)cc23)C1 |
| InChI | InChI=1S/C22H21F3N2O3/c1-11(10-28)26-22(29)30-16-6-13(7-16)19-17-8-15(24)9-18(25)21(17)27-20(19)12-2-4-14(23)5-3-12/h2-5,8-9,11,13,16,27-28H,6-7,10H2,1H3,(H,26,29) |
| InChIKey | QTUSJBMMBBNGFI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate?
The IUPAC name of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate (CID 166008615) is [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate.
What is the SMILES notation for [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate?
The canonical SMILES for [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate is CC(CO)NC(=O)OC1CC(c2c(-c3ccc(F)cc3)[nH]c3c(F)cc(F)cc23)C1.
What is the InChIKey of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate?
The InChIKey is QTUSJBMMBBNGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F3N2O3/c1-11(10-28)26-22(29)30-16-6-13(7-16)19-17-8-15(24)9-18(25)21(17)27-20(19)12-2-4-14(23)5-3-12/h2-5,8-9,11,13,16,27-28H,6-7,10H2,1H3,(H,26,29).
What are the key properties of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate?
[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate has a molecular weight of 418.42 g/mol, XLogP of 4.61, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-(1-hydroxypropan-2-yl)carbamate is sourced from PubChem (CID 166008615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).