About [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate
[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate (PubChem CID 166008698) has the molecular formula C22H19F3N2O2
and a molecular weight of 400.40 g/mol. Its IUPAC name is [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate.
Molecular Properties
| Compound Name | [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate |
| PubChem CID | 166008698 |
| Molecular Formula | C22H19F3N2O2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate |
| SMILES | O=C(NC1CC1)OC1CC(c2c(-c3ccc(F)cc3)[nH]c3c(F)cc(F)cc23)C1 |
| InChI | InChI=1S/C22H19F3N2O2/c23-13-3-1-11(2-4-13)20-19(17-9-14(24)10-18(25)21(17)27-20)12-7-16(8-12)29-22(28)26-15-5-6-15/h1-4,9-10,12,15-16,27H,5-8H2,(H,26,28) |
| InChIKey | KMNLZPWJCRNINM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate?
The IUPAC name of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate (CID 166008698) is [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate.
What is the SMILES notation for [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate?
The canonical SMILES for [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate is O=C(NC1CC1)OC1CC(c2c(-c3ccc(F)cc3)[nH]c3c(F)cc(F)cc23)C1.
What is the InChIKey of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate?
The InChIKey is KMNLZPWJCRNINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F3N2O2/c23-13-3-1-11(2-4-13)20-19(17-9-14(24)10-18(25)21(17)27-20)12-7-16(8-12)29-22(28)26-15-5-6-15/h1-4,9-10,12,15-16,27H,5-8H2,(H,26,28).
What are the key properties of [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate?
[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate has a molecular weight of 400.40 g/mol, XLogP of 5.39, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] N-cyclopropylcarbamate is sourced from PubChem (CID 166008698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).