About 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine
2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine (PubChem CID 166008876) has the molecular formula C11H17F3N2O
and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine |
| PubChem CID | 166008876 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine |
| SMILES | COC1C=C(C(F)(F)F)C(CCN(C)C)=CN1 |
| InChI | InChI=1S/C11H17F3N2O/c1-16(2)5-4-8-7-15-10(17-3)6-9(8)11(12,13)14/h6-7,10,15H,4-5H2,1-3H3 |
| InChIKey | QRYYPFUYVKWNRK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine (CID 166008876) is 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine is COC1C=C(C(F)(F)F)C(CCN(C)C)=CN1.
What is the InChIKey of 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine?
The InChIKey is QRYYPFUYVKWNRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2O/c1-16(2)5-4-8-7-15-10(17-3)6-9(8)11(12,13)14/h6-7,10,15H,4-5H2,1-3H3.
What are the key properties of 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine?
2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine has a molecular weight of 250.26 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-methoxy-4-(trifluoromethyl)-1,2-dihydropyridin-5-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 166008876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).