C9H12N2O — CID 166008882
4-methyl-1,2,5,6-tetrahydropyrrolo[3,2-b]pyridine-3-carbaldehyde (PubChem CID 166008882) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 4-methyl-1,2,5,6-tetrahydropyrrolo[3,2-b]pyridine-3-carbaldehyde.
| Compound Name | 4-methyl-1,2,5,6-tetrahydropyrrolo[3,2-b]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 166008882 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 4-methyl-1,2,5,6-tetrahydropyrrolo[3,2-b]pyridine-3-carbaldehyde |
| SMILES | CN1CCC=C2NCC(C=O)=C21 |
| InChI | InChI=1S/C9H12N2O/c1-11-4-2-3-8-9(11)7(6-12)5-10-8/h3,6,10H,2,4-5H2,1H3 |
| InChIKey | INXLGBXBEGHMBX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|