C21H24N6O — CID 166010208
8-[(3-aminophenyl)methyl]-7-tert-butyl-4-(5-methylfuran-2-yl)pyrazolo[1,5-a][1,3,5]triazin-2-amine (PubChem CID 166010208) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 8-[(3-aminophenyl)methyl]-7-tert-butyl-4-(5-methylfuran-2-yl)pyrazolo[1,5-a][1,3,5]triazin-2-amine.
| Compound Name | 8-[(3-aminophenyl)methyl]-7-tert-butyl-4-(5-methylfuran-2-yl)pyrazolo[1,5-a][1,3,5]triazin-2-amine |
|---|---|
| PubChem CID | 166010208 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 8-[(3-aminophenyl)methyl]-7-tert-butyl-4-(5-methylfuran-2-yl)pyrazolo[1,5-a][1,3,5]triazin-2-amine |
| SMILES | Cc1ccc(-c2nc(N)nc3c(Cc4cccc(N)c4)c(C(C)(C)C)nn23)o1 |
| InChI | InChI=1S/C21H24N6O/c1-12-8-9-16(28-12)19-25-20(23)24-18-15(11-13-6-5-7-14(22)10-13)17(21(2,3)4)26-27(18)19/h5-10H,11,22H2,1-4H3,(H2,23,24) |
| InChIKey | MWIXNFFNZDJHHY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|