C37H59O4P — CID 166010470
methyl (4-methylphenyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphite (PubChem CID 166010470) has the molecular formula C37H59O4P and a molecular weight of 598.85 g/mol. Its IUPAC name is methyl (4-methylphenyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphite.
| Compound Name | methyl (4-methylphenyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphite |
|---|---|
| PubChem CID | 166010470 |
| Molecular Formula | C37H59O4P |
| Molecular Weight | 598.85 g/mol |
| Exact Mass | 598.42 |
| IUPAC Name | methyl (4-methylphenyl) [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphite |
| SMILES | COP(Oc1ccc(C)cc1)Oc1c(C)c(C)c2c(c1C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C37H59O4P/c1-26(2)14-11-15-27(3)16-12-17-28(4)18-13-24-37(9)25-23-34-32(8)35(30(6)31(7)36(34)39-37)41-42(38-10)40-33-21-19-29(5)20-22-33/h19-22,26-28H,11-18,23-25H2,1-10H3 |
| InChIKey | WBAQDUJYRBKIOI-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.85 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|