C15H17N4+ — CID 166010734
5,8-dimethyl-2,13,17-triaza-5-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11-hexaene (PubChem CID 166010734) has the molecular formula C15H17N4+ and a molecular weight of 253.33 g/mol. Its IUPAC name is 5,8-dimethyl-2,13,17-triaza-5-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11-hexaene.
| Compound Name | 5,8-dimethyl-2,13,17-triaza-5-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 166010734 |
| Molecular Formula | C15H17N4+ |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 5,8-dimethyl-2,13,17-triaza-5-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11-hexaene |
| SMILES | Cc1cccc2c1-c1n(cc[n+]1C)C1=NCCCN12 |
| InChI | InChI=1S/C15H17N4/c1-11-5-3-6-12-13(11)14-17(2)9-10-19(14)15-16-7-4-8-18(12)15/h3,5-6,9-10H,4,7-8H2,1-2H3/q+1 |
| InChIKey | IQKWZYKWMWEURN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 24.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|